5-Br-Lophophine
2-(7-Bromo-2H-1,3-benzodioxol-5-yl)ethan-1-amine
 10294 C9H10BrNO2 244.085
 InChI=1S/C9H10BrNO2/c10-7-3-6(1-2-11)4-8-9(7)13-5-12-8/h3-4H,1-2,5,11H2
 SIFKOXFOCAHLDN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(Br)c2c(c1)OCO2