4-I-3,5-DMA
1-(4-Iodo-3,5-dimethoxyphenyl)propan-2-amine
 10293 C11H16INO2 321.155
 InChI=1S/C11H16INO2/c1-7(13)4-8-5-9(14-2)11(12)10(6-8)15-3/h5-7H,4,13H2,1-3H3
 FFXXOZAVLNQXLC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)cc(c1I)OC