3-TMAL
2-{3-Methoxy-4-[(2-methylprop-2-en-1-yl)oxy]-5-(methylsulfanyl)phenyl}ethan-1-amine
 10292 C14H21NO2S 267.387
 InChI=1S/C14H21NO2S/c1-10(2)9-17-14-12(16-3)7-11(5-6-15)8-13(14)18-4/h7-8H,1,5-6,9,15H2,2-4H3
 LZVCJCGPXHPRRH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)SC)OCC(=C)C