3-TFAL
2-{4-[(2-Fluoroprop-2-en-1-yl)oxy]-3-methoxy-5-(methylsulfanyl)phenyl}ethan-1-amine
 10291 C13H18FNO2S 271.351
 InChI=1S/C13H18FNO2S/c1-9(14)8-17-13-11(16-2)6-10(4-5-15)7-12(13)18-3/h6-7H,1,4-5,8,15H2,2-3H3
 VDPMPOCYABHYBB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)SC)OCC(=C)F