3-TAL
2-{3-Methoxy-5-(methylsulfanyl)-4-[(prop-2-en-1-yl)oxy]phenyl}ethan-1-amine
 10290 C13H19NO2S 253.36
 InChI=1S/C13H19NO2S/c1-4-7-16-13-11(15-2)8-10(5-6-14)9-12(13)17-3/h4,8-9H,1,5-7,14H2,2-3H3
 WJTYHKLQYZRQRB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCOc1c(OC)cc(cc1SC)CCN