4′-Methylphendimetrazine
3,4-Dimethyl-2-(4-methylphenyl)morpholine
 1029 C13H19NO 205.296
 InChI=1S/C13H19NO/c1-10-4-6-12(7-5-10)13-11(2)14(3)8-9-15-13/h4-7,11,13H,8-9H2,1-3H3
 UJDFQROPBYDNBJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCOC(C1C)c1ccc(cc1)C