3-TTFE
2-[3-Methoxy-5-(methylsulfanyl)-4-(2,2,2-trifluoroethoxy)phenyl]ethan-1-amine
 10289 C12H16F3NO2S 295.321
 InChI=1S/C12H16F3NO2S/c1-17-9-5-8(3-4-16)6-10(19-2)11(9)18-7-12(13,14)15/h5-6H,3-4,7,16H2,1-2H3
 DZHMWFGAIUCWOY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)SC)OCC(F)(F)F