3-TIP
2-{3-Methoxy-5-(methylsulfanyl)-4-[(propan-2-yl)oxy]phenyl}ethan-1-amine
 10288 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-9(2)16-13-11(15-3)7-10(5-6-14)8-12(13)17-4/h7-9H,5-6,14H2,1-4H3
 INPNDHZMGAZGMM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)SC)OC(C)C