3-TTFM
2-[3-Methoxy-5-(methylsulfanyl)-4-(trifluoromethoxy)phenyl]ethan-1-amine
 10287  C11H14F3NO2S  281.295
 InChI=1S/C11H14F3NO2S/c1-16-8-5-7(3-4-15)6-9(18-2)10(8)17-11(12,13)14/h5-6H,3-4,15H2,1-2H3
 YGZGQJVFKORQHV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)SC)OC(F)(F)F