3-TDFM
2-[4-(Difluoromethoxy)-3-methoxy-5-(methylsulfanyl)phenyl]ethan-1-amine
 10286  C11H15F2NO2S  263.304
 InChI=1S/C11H15F2NO2S/c1-15-8-5-7(3-4-14)6-9(17-2)10(8)16-11(12)13/h5-6,11H,3-4,14H2,1-2H3
 YFPKDXRMOGEZOB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)SC)OC(F)F