2-[3,4,5-Tris(fluoromethoxy)phenyl]ethan-1-amine
 10285 C11H14F3NO3 265.229
 InChI=1S/C11H14F3NO3/c12-5-16-9-3-8(1-2-15)4-10(17-6-13)11(9)18-7-14/h3-4H,1-2,5-7,15H2
 CJDZHHPZOHOWMM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OCF)c(c(c1)OCF)OCF