2-[3-Methoxy-4,5-bis(trifluoromethoxy)phenyl]ethan-1-amine
 10284 C11H11F6NO3 319.2
 InChI=1S/C11H11F6NO3/c1-19-7-4-6(2-3-18)5-8(20-10(12,13)14)9(7)21-11(15,16)17/h4-5H,2-3,18H2,1H3
 HMESCDIUCYDEIH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC(F)(F)F)c(c(c1)OC)OC(F)(F)F