2-[3,5-Bis(difluoromethoxy)-4-methoxyphenyl]ethan-1-amine
 10283 C11H13F4NO3 283.219
 InChI=1S/C11H13F4NO3/c1-17-9-7(18-10(12)13)4-6(2-3-16)5-8(9)19-11(14)15/h4-5,10-11H,2-3,16H2,1H3
 VGJJJMXFHGEWLM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC(F)F)c(c(c1)OC(F)F)OC