PFE
2-[3,5-Dimethoxy-4-(pentafluoroethoxy)phenyl]ethan-1-amine
 10279 C12H14F5NO3 315.236
 InChI=1S/C12H14F5NO3/c1-19-8-5-7(3-4-18)6-9(20-2)10(8)21-12(16,17)11(13,14)15/h5-6H,3-4,18H2,1-2H3
 YYOXVBJLPLSQFT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC(C(F)(F)F)(F)F