1,1,2,2-TFE
2-[3,5-Dimethoxy-4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethan-1-amine
 10278 C12H15F4NO3 297.246
 InChI=1S/C12H15F4NO3/c1-18-8-5-7(3-4-17)6-9(19-2)10(8)20-12(15,16)11(13)14/h5-6,11H,3-4,17H2,1-2H3
 WUBCYGXRFHTJAI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC(C(F)F)(F)F