1,1,2-TFE
2-[3,5-Dimethoxy-4-(1,1,2-trifluoroethoxy)phenyl]ethan-1-amine
 10277 C12H16F3NO3 279.256
 InChI=1S/C12H16F3NO3/c1-17-9-5-8(3-4-16)6-10(18-2)11(9)19-12(14,15)7-13/h5-6H,3-4,7,16H2,1-2H3
 ZMSKFLQHLIXIOP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC(CF)(F)F