1,2,2,2-TFE
2-[3,5-Dimethoxy-4-(1,2,2,2-tetrafluoroethoxy)phenyl]ethan-1-amine
 10276  C12H15F4NO3  297.246
 InChI=1S/C12H15F4NO3/c1-18-8-5-7(3-4-17)6-9(19-2)10(8)20-11(13)12(14,15)16/h5-6,11H,3-4,17H2,1-2H3
 OBUANVNNQXANMV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC(C(F)(F)F)F