1,2,2-TFE
2-[3,5-Dimethoxy-4-(1,2,2-trifluoroethoxy)phenyl]ethan-1-amine
 10275 C12H16F3NO3 279.256
 InChI=1S/C12H16F3NO3/c1-17-8-5-7(3-4-16)6-9(18-2)10(8)19-12(15)11(13)14/h5-6,11-12H,3-4,16H2,1-2H3
 OQDQVVZRDLNOPZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC(C(F)F)F