1,2-DFE
2-[4-(1,2-Difluoroethoxy)-3,5-dimethoxyphenyl]ethan-1-amine
 10274 C12H17F2NO3 261.265
 InChI=1S/C12H17F2NO3/c1-16-9-5-8(3-4-15)6-10(17-2)12(9)18-11(14)7-13/h5-6,11H,3-4,7,15H2,1-2H3
 OMSSVXVZKQYGDC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC(CF)F