1-FE
2-[4-(1-Fluoroethoxy)-3,5-dimethoxyphenyl]ethan-1-amine
 10272 C12H18FNO3 243.275
 InChI=1S/C12H18FNO3/c1-8(13)17-12-10(15-2)6-9(4-5-14)7-11(12)16-3/h6-8H,4-5,14H2,1-3H3
 KMKSDYYWZCZZST-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC(F)C