MeSEtO
2-{3,5-Dimethoxy-4-[2-(methylsulfanyl)ethoxy]phenyl}ethan-1-amine
 10268 C13H21NO3S 271.376
 InChI=1S/C13H21NO3S/c1-15-11-8-10(4-5-14)9-12(16-2)13(11)17-6-7-18-3/h8-9H,4-7,14H2,1-3H3
 XJNRXCDRIZCDES-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CSCCOc1c(OC)cc(cc1OC)CCN