1,2,3-Trimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine
 10258 C14H21NO3 251.321
 InChI=1S/C14H21NO3/c1-16-12-8-9-7-10(15)5-4-6-11(9)13(17-2)14(12)18-3/h8,10H,4-7,15H2,1-3H3
 ZPSMHQPMFJPPNP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc2CC(N)CCCc2c(c1OC)OC