β-Fluoromescaline
2-Fluoro-2-(3,4,5-trimethoxyphenyl)ethan-1-amine
 10255 C11H16FNO3 229.248
 InChI=1S/C11H16FNO3/c1-14-9-4-7(8(12)6-13)5-10(15-2)11(9)16-3/h4-5,8H,6,13H2,1-3H3
 WJJFRQWHMSRSJV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1cc(OC)c(c(c1)OC)OC)F