ψ-2C-C
2-(4-Chloro-2,6-dimethoxyphenyl)ethan-1-amine
 10244 C10H14ClNO2 215.677
 InChI=1S/C10H14ClNO2/c1-13-9-5-7(11)6-10(14-2)8(9)3-4-12/h5-6H,3-4,12H2,1-2H3
 UTPHSBFMXMVRRW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)cc(cc1OC)Cl