ψ-MMALM
1-{2,6-Dimethoxy-4-[(2-methylprop-2-en-1-yl)oxy]phenyl}propan-2-amine
 10242 C15H23NO3 265.348
 InChI=1S/C15H23NO3/c1-10(2)9-19-12-7-14(17-4)13(6-11(3)16)15(8-12)18-5/h7-8,11H,1,6,9,16H2,2-5H3
 GWVRVXDFYHOSSZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OCC(=C)C)cc(c1CC(N)C)OC