ψ-MEM
1-(4-Ethoxy-2,6-dimethoxyphenyl)propan-2-amine
 10240 C13H21NO3 239.311
 InChI=1S/C13H21NO3/c1-5-17-10-7-12(15-3)11(6-9(2)14)13(8-10)16-4/h7-9H,5-6,14H2,1-4H3
 YLVXLSQLKDWFSL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(OC)c(c(c1)OC)CC(N)C