ψ-2C-O-3
2-{2,6-Dimethoxy-4-[(2-methylprop-2-en-1-yl)oxy]phenyl}ethan-1-amine
 10239 C14H21NO3 251.321
 InChI=1S/C14H21NO3/c1-10(2)9-18-11-7-13(16-3)12(5-6-15)14(8-11)17-4/h7-8H,1,5-6,9,15H2,2-4H3
 ZKALECSIHBWMFM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)cc(cc1OC)OCC(=C)C