N-[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]formamide
 10213  C11H13NO3  207.226
 InChI=1S/C11H13NO3/c1-8(12-6-13)4-9-2-3-10-11(5-9)15-7-14-10/h2-3,5-6,8H,4,7H2,1H3,(H,12,13)
 WGGJEXIHYZZZGU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=CNC(Cc1ccc2c(c1)OCO2)C