5-(2-Aminopropyl)-2H-1,3-benzodioxol-2-one
 10205  C10H11NO3  193.199
 InChI=1S/C10H11NO3/c1-6(11)4-7-2-3-8-9(5-7)14-10(12)13-8/h2-3,5-6H,4,11H2,1H3
 DQLNXSANNFBJLS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc2c(c1)oc(=O)o2)N