2-(2H-1,3-Benzodioxol-5-yl)-1-cyclopropylethan-1-amine
 10180  C12H15NO2  205.253
 InChI=1S/C12H15NO2/c13-10(9-2-3-9)5-8-1-4-11-12(6-8)15-7-14-11/h1,4,6,9-10H,2-3,5,7,13H2
 DJDHTVOJEYOOGY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC(C1CC1)Cc1ccc2c(c1)OCO2