1-(2H-1,3-Benzodioxol-5-yl)pent-4-en-2-amine
 10176  C12H15NO2  205.253
 InChI=1S/C12H15NO2/c1-2-3-10(13)6-9-4-5-11-12(7-9)15-8-14-11/h2,4-5,7,10H,1,3,6,8,13H2
 YPFPLGMZPJFFBZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCC(Cc1ccc2c(c1)OCO2)N