ATK-0104
1-(2H-1,3-Benzodioxol-5-yl)-N,3-dimethylbutan-2-amine
 10174 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-9(2)11(14-3)6-10-4-5-12-13(7-10)16-8-15-12/h4-5,7,9,11,14H,6,8H2,1-3H3
 UEVRNSSAHWZFRQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(C)C)Cc1ccc2c(c1)OCO2