1-[4-Chloro-3-(trifluoromethyl)phenyl]propan-2-amine
 10165  C10H11ClF3N  237.649
 InChI=1S/C10H11ClF3N/c1-6(15)4-7-2-3-9(11)8(5-7)10(12,13)14/h2-3,5-6H,4,15H2,1H3
 HZSSZTZLKVHTEA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(c(c1)C(F)(F)F)Cl)N