4-(2-Aminopropyl)-2-bromo-N,N-dimethylaniline
 10155  C11H17BrN2  257.17
 InChI=1S/C11H17BrN2/c1-8(13)6-9-4-5-11(14(2)3)10(12)7-9/h4-5,7-8H,6,13H2,1-3H3
 LIIZKMKTZVALJX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(c(c1)Br)N(C)C)N