4-(2-Aminoethyl)-2-bromophenol
 10154  C8H10BrNO  216.075
 InChI=1S/C8H10BrNO/c9-7-5-6(3-4-10)1-2-8(7)11/h1-2,5,11H,3-4,10H2
 KIKCGMHGZPBUNQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)Br)O