5-(2-Aminopropyl)-2-ethylphenol
 10145 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-3-10-5-4-9(6-8(2)12)7-11(10)13/h4-5,7-8,13H,3,6,12H2,1-2H3
 HLCCQFOLOPQJGC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCc1ccc(cc1O)CC(N)C