1-(4-Iodo-3-methoxyphenyl)propan-2-amine
 10138  C10H14INO  291.129
 InChI=1S/C10H14INO/c1-7(12)5-8-3-4-9(11)10(6-8)13-2/h3-4,6-7H,5,12H2,1-2H3
 XQYTYIKBMANLAR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(ccc1I)CC(N)C