2,4-Bis(2-aminoethyl)phenol
 10099  C10H16N2O  180.247
 InChI=1S/C10H16N2O/c11-5-3-8-1-2-10(13)9(7-8)4-6-12/h1-2,7,13H,3-6,11-12H2
 RIJGXIJJZIXOAC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)CCN)O