2-(5-Ethyl-2-methoxyphenyl)ethan-1-amine
 10091 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-3-9-4-5-11(13-2)10(8-9)6-7-12/h4-5,8H,3,6-7,12H2,1-2H3
 ORIZFYDJRSUBPF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(CC)ccc1OC