2DF-2C-H
2-[2-(Difluoromethoxy)-5-methoxyphenyl]ethan-1-amine
 10085  C10H13F2NO2  217.213
 InChI=1S/C10H13F2NO2/c1-14-8-2-3-9(15-10(11)12)7(6-8)4-5-13/h2-3,6,10H,4-5,13H2,1H3
 KHNFEFOYXMJUCV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)ccc1OC(F)F