2-(2-Chloro-4-nitrophenoxy)-N,N-diethylethan-1-amine
 10069 C12H17ClN2O3 272.728
 InChI=1S/C12H17ClN2O3/c1-3-14(4-2)7-8-18-12-6-5-10(15(16)17)9-11(12)13/h5-6,9H,3-4,7-8H2,1-2H3
 IUHSJKYKAMWUFM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCOc1ccc(cc1Cl)N(=O)=O)CC