2-(2,4-Dinitrophenoxy)-N,N-diethylethan-1-amine
 10067 C12H17N3O5 283.28
 InChI=1S/C12H17N3O5/c1-3-13(4-2)7-8-20-12-6-5-10(14(16)17)9-11(12)15(18)19/h5-6,9H,3-4,7-8H2,1-2H3
 ADHUAAOMDQPOLX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCOc1ccc(cc1N(=O)=O)N(=O)=O)CC