1-(2,4-Dimethylphenyl)-2-[(propan-2-yl)amino]propan-1-ol
 10065 C14H23NO 221.339
 InChI=1S/C14H23NO/c1-9(2)15-12(5)14(16)13-7-6-10(3)8-11(13)4/h6-9,12,14-16H,1-5H3
 HCIRNMMFGFNIGA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC(C(c1ccc(cc1C)C)O)C)C