2,4-DNPEA
2-(2,4-Dinitrophenyl)ethan-1-amine
 10064 C8H9N3O4 211.175
 InChI=1S/C8H9N3O4/c9-4-3-6-1-2-7(10(12)13)5-8(6)11(14)15/h1-2,5H,3-4,9H2
 YKMOOBLAWBCXFX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1N(=O)=O)N(=O)=O