2,4-DAPEA
4-(2-Aminoethyl)benzene-1,3-diamine
 10063 C8H13N3 151.209
 InChI=1S/C8H13N3/c9-4-3-6-1-2-7(10)5-8(6)11/h1-2,5H,3-4,9-11H2
 AVKJTBFHXAKKER-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1N)N