4-(2-Amino-2-methylpropyl)-N,N,3-trimethylaniline
 10060 C13H22N2 206.327
 InChI=1S/C13H22N2/c1-10-8-12(15(4)5)7-6-11(10)9-13(2,3)14/h6-8H,9,14H2,1-5H3
 ZVEWQRHRTYEVRZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1cc(ccc1CC(N)(C)C)N(C)C