4-Isopropoxy-2-methylamphetamine
1-{2-Methyl-4-[(propan-2-yl)oxy]phenyl}propan-2-amine
 10059 C13H21NO 207.312
 InChI=1S/C13H21NO/c1-9(2)15-13-6-5-12(8-11(4)14)10(3)7-13/h5-7,9,11H,8,14H2,1-4H3
 YBUIXZIMOGQCJD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1C)OC(C)C)N