4-Methoxy-2-methylamphetamine
1-(4-Methoxy-2-methylphenyl)propan-2-amine
 10057 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-8-6-11(13-3)5-4-10(8)7-9(2)12/h4-6,9H,7,12H2,1-3H3
 DHAOQKNAJHSJRO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c(c1)C)CC(N)C