4-(2-Aminopropyl)-3-bromo-N,N-dimethylaniline
 10056 C11H17BrN2 257.17
 InChI=1S/C11H17BrN2/c1-8(13)6-9-4-5-10(14(2)3)7-11(9)12/h4-5,7-8H,6,13H2,1-3H3
 HARGFOZNYKJJBV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1Br)N(C)C)N