4-(2-Aminopropyl)-3-chloro-N,N-dimethylaniline
 10053  C11H17ClN2  212.719
 InChI=1S/C11H17ClN2/c1-8(13)6-9-4-5-10(14(2)3)7-11(9)12/h4-5,7-8H,6,13H2,1-3H3
 PHXIYUHXUSLPNG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1Cl)N(C)C)N